C28H22ClF2N3O — CID 121335107
1-[3-[2-chloro-4-(4-fluorophenyl)phenoxy]propyl]-6-(4-fluorophenyl)benzimidazol-2-amine (PubChem CID 121335107) has the molecular formula C28H22ClF2N3O and a molecular weight of 489.95 g/mol. Its IUPAC name is 1-[3-[2-chloro-4-(4-fluorophenyl)phenoxy]propyl]-6-(4-fluorophenyl)benzimidazol-2-amine.
| Compound Name | 1-[3-[2-chloro-4-(4-fluorophenyl)phenoxy]propyl]-6-(4-fluorophenyl)benzimidazol-2-amine |
|---|---|
| PubChem CID | 121335107 |
| Molecular Formula | C28H22ClF2N3O |
| Molecular Weight | 489.95 g/mol |
| Exact Mass | 489.14 |
| IUPAC Name | 1-[3-[2-chloro-4-(4-fluorophenyl)phenoxy]propyl]-6-(4-fluorophenyl)benzimidazol-2-amine |
| SMILES | Nc1nc2ccc(-c3ccc(F)cc3)cc2n1CCCOc1ccc(-c2ccc(F)cc2)cc1Cl |
| InChI | InChI=1S/C28H22ClF2N3O/c29-24-16-20(18-2-8-22(30)9-3-18)7-13-27(24)35-15-1-14-34-26-17-21(6-12-25(26)33-28(34)32)19-4-10-23(31)11-5-19/h2-13,16-17H,1,14-15H2,(H2,32,33) |
| InChIKey | FFOZTDSZPOGNIZ-UHFFFAOYSA-N |
| XLogP | 7.35 |
| TPSA | 53.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.95 |
| LogP ≤ 5 | 7.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|