C34H33ClF2N4O — CID 121335157
3-[3-[2-chloro-4-(4-fluorophenyl)phenoxy]propyl]-5-(4-fluorophenyl)-1-(2-pyrrolidin-1-ylethyl)benzimidazol-2-imine (PubChem CID 121335157) has the molecular formula C34H33ClF2N4O and a molecular weight of 587.11 g/mol. Its IUPAC name is 3-[3-[2-chloro-4-(4-fluorophenyl)phenoxy]propyl]-5-(4-fluorophenyl)-1-(2-pyrrolidin-1-ylethyl)benzimidazol-2-imine.
| Compound Name | 3-[3-[2-chloro-4-(4-fluorophenyl)phenoxy]propyl]-5-(4-fluorophenyl)-1-(2-pyrrolidin-1-ylethyl)benzimidazol-2-imine |
|---|---|
| PubChem CID | 121335157 |
| Molecular Formula | C34H33ClF2N4O |
| Molecular Weight | 587.11 g/mol |
| Exact Mass | 586.23 |
| IUPAC Name | 3-[3-[2-chloro-4-(4-fluorophenyl)phenoxy]propyl]-5-(4-fluorophenyl)-1-(2-pyrrolidin-1-ylethyl)benzimidazol-2-imine |
| SMILES | [H]/N=c1/n(CCCOc2ccc(-c3ccc(F)cc3)cc2Cl)c2cc(-c3ccc(F)cc3)ccc2n1CCN1CCCC1 |
| InChI | InChI=1S/C34H33ClF2N4O/c35-30-22-26(24-4-10-28(36)11-5-24)9-15-33(30)42-21-3-18-40-32-23-27(25-6-12-29(37)13-7-25)8-14-31(32)41(34(40)38)20-19-39-16-1-2-17-39/h4-15,22-23,38H,1-3,16-21H2/b38-34- |
| InChIKey | LZSIFOYRXGUNFC-RXJYLVDRSA-N |
| XLogP | 7.75 |
| TPSA | 46.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.11 |
| LogP ≤ 5 | 7.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|