C6H12N2 — CID 121336326
(4R,5R)-2-azabicyclo[2.2.1]heptan-5-amine (PubChem CID 121336326) has the molecular formula C6H12N2 and a molecular weight of 112.18 g/mol. Its IUPAC name is (4R,5R)-2-azabicyclo[2.2.1]heptan-5-amine.
| Compound Name | (4R,5R)-2-azabicyclo[2.2.1]heptan-5-amine |
|---|---|
| PubChem CID | 121336326 |
| Molecular Formula | C6H12N2 |
| Molecular Weight | 112.18 g/mol |
| Exact Mass | 112.10 |
| IUPAC Name | (4R,5R)-2-azabicyclo[2.2.1]heptan-5-amine |
| SMILES | N[C@@H]1CC2C[C@@H]1CN2 |
| InChI | InChI=1S/C6H12N2/c7-6-2-5-1-4(6)3-8-5/h4-6,8H,1-3,7H2/t4-,5?,6-/m1/s1 |
| InChIKey | IAXKDYYTMWUUIA-SPWIIUKKSA-N |
| XLogP | -0.30 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 112.18 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |