About (2-oxo-3-phenyl-1H-quinolin-4-yl) 4-methylbenzenesulfinate
(2-oxo-3-phenyl-1H-quinolin-4-yl) 4-methylbenzenesulfinate (PubChem CID 121337977) has the molecular formula C22H17NO3S
and a molecular weight of 375.45 g/mol. Its IUPAC name is (2-oxo-3-phenyl-1H-quinolin-4-yl) 4-methylbenzenesulfinate.
Molecular Properties
| Compound Name | (2-oxo-3-phenyl-1H-quinolin-4-yl) 4-methylbenzenesulfinate |
| PubChem CID | 121337977 |
| Molecular Formula | C22H17NO3S |
| Molecular Weight | 375.45 g/mol |
| Exact Mass | 375.09 |
| IUPAC Name | (2-oxo-3-phenyl-1H-quinolin-4-yl) 4-methylbenzenesulfinate |
| SMILES | Cc1ccc(S(=O)Oc2c(-c3ccccc3)c(=O)[nH]c3ccccc23)cc1 |
| InChI | InChI=1S/C22H17NO3S/c1-15-11-13-17(14-12-15)27(25)26-21-18-9-5-6-10-19(18)23-22(24)20(21)16-7-3-2-4-8-16/h2-14H,1H3,(H,23,24) |
| InChIKey | QSPOPWDVNHUNTF-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 59.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 375.45 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2-oxo-3-phenyl-1H-quinolin-4-yl) 4-methylbenzenesulfinate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-oxo-3-phenyl-1H-quinolin-4-yl) 4-methylbenzenesulfinate?
The IUPAC name of (2-oxo-3-phenyl-1H-quinolin-4-yl) 4-methylbenzenesulfinate (CID 121337977) is (2-oxo-3-phenyl-1H-quinolin-4-yl) 4-methylbenzenesulfinate.
What is the SMILES notation for (2-oxo-3-phenyl-1H-quinolin-4-yl) 4-methylbenzenesulfinate?
The canonical SMILES for (2-oxo-3-phenyl-1H-quinolin-4-yl) 4-methylbenzenesulfinate is Cc1ccc(S(=O)Oc2c(-c3ccccc3)c(=O)[nH]c3ccccc23)cc1.
What is the InChIKey of (2-oxo-3-phenyl-1H-quinolin-4-yl) 4-methylbenzenesulfinate?
The InChIKey is QSPOPWDVNHUNTF-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H17NO3S/c1-15-11-13-17(14-12-15)27(25)26-21-18-9-5-6-10-19(18)23-22(24)20(21)16-7-3-2-4-8-16/h2-14H,1H3,(H,23,24).
What are the key properties of (2-oxo-3-phenyl-1H-quinolin-4-yl) 4-methylbenzenesulfinate?
(2-oxo-3-phenyl-1H-quinolin-4-yl) 4-methylbenzenesulfinate has a molecular weight of 375.45 g/mol, XLogP of 4.61, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2-oxo-3-phenyl-1H-quinolin-4-yl) 4-methylbenzenesulfinate is sourced from PubChem (CID 121337977), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).