C12H12F3IN4O — CID 121338469
N-methyl-N-[(1R,5S)-3-[4-(trifluoromethyl)pyrimidin-2-yl]-3-azabicyclo[3.1.0]hexan-6-yl]carbamoyl iodide (PubChem CID 121338469) has the molecular formula C12H12F3IN4O and a molecular weight of 412.15 g/mol. Its IUPAC name is N-methyl-N-[(1R,5S)-3-[4-(trifluoromethyl)pyrimidin-2-yl]-3-azabicyclo[3.1.0]hexan-6-yl]carbamoyl iodide.
| Compound Name | N-methyl-N-[(1R,5S)-3-[4-(trifluoromethyl)pyrimidin-2-yl]-3-azabicyclo[3.1.0]hexan-6-yl]carbamoyl iodide |
|---|---|
| PubChem CID | 121338469 |
| Molecular Formula | C12H12F3IN4O |
| Molecular Weight | 412.15 g/mol |
| Exact Mass | 412.00 |
| IUPAC Name | N-methyl-N-[(1R,5S)-3-[4-(trifluoromethyl)pyrimidin-2-yl]-3-azabicyclo[3.1.0]hexan-6-yl]carbamoyl iodide |
| SMILES | CN(C(=O)I)C1[C@H]2CN(c3nccc(C(F)(F)F)n3)C[C@@H]12 |
| InChI | InChI=1S/C12H12F3IN4O/c1-19(10(16)21)9-6-4-20(5-7(6)9)11-17-3-2-8(18-11)12(13,14)15/h2-3,6-7,9H,4-5H2,1H3/t6-,7+,9? |
| InChIKey | UPAFUSYBOOUNKM-AVSFMBPQSA-N |
| XLogP | 2.42 |
| TPSA | 49.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.15 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|