C19H32O2 — CID 121338763
(2S,3S)-5-methoxy-3-[(3E)-3-methylhexa-3,5-dienyl]-2-[(E)-2-methylhex-1-enyl]oxolane (PubChem CID 121338763) has the molecular formula C19H32O2 and a molecular weight of 292.46 g/mol. Its IUPAC name is (2S,3S)-5-methoxy-3-[(3E)-3-methylhexa-3,5-dienyl]-2-[(E)-2-methylhex-1-enyl]oxolane.
| Compound Name | (2S,3S)-5-methoxy-3-[(3E)-3-methylhexa-3,5-dienyl]-2-[(E)-2-methylhex-1-enyl]oxolane |
|---|---|
| PubChem CID | 121338763 |
| Molecular Formula | C19H32O2 |
| Molecular Weight | 292.46 g/mol |
| Exact Mass | 292.24 |
| IUPAC Name | (2S,3S)-5-methoxy-3-[(3E)-3-methylhexa-3,5-dienyl]-2-[(E)-2-methylhex-1-enyl]oxolane |
| SMILES | C=C/C=C(\C)CC[C@H]1CC(OC)O[C@@H]1/C=C(\C)CCCC |
| InChI | InChI=1S/C19H32O2/c1-6-8-10-16(4)13-18-17(14-19(20-5)21-18)12-11-15(3)9-7-2/h7,9,13,17-19H,2,6,8,10-12,14H2,1,3-5H3/b15-9+,16-13+/t17-,18+,19?/m0/s1 |
| InChIKey | NBLGJIYDOWYRJA-MELJTJRLSA-N |
| XLogP | 5.41 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.46 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|