C33H29F3N6O2 — CID 121339544
1-(4-methylphenyl)-3-[3-(1-phenylprop-2-enyl)-5-[2-(2H-tetrazol-5-yl)phenyl]-2-(3,3,3-trifluoropropoxy)phenyl]urea (PubChem CID 121339544) has the molecular formula C33H29F3N6O2 and a molecular weight of 598.63 g/mol. Its IUPAC name is 1-(4-methylphenyl)-3-[3-(1-phenylprop-2-enyl)-5-[2-(2H-tetrazol-5-yl)phenyl]-2-(3,3,3-trifluoropropoxy)phenyl]urea.
| Compound Name | 1-(4-methylphenyl)-3-[3-(1-phenylprop-2-enyl)-5-[2-(2H-tetrazol-5-yl)phenyl]-2-(3,3,3-trifluoropropoxy)phenyl]urea |
|---|---|
| PubChem CID | 121339544 |
| Molecular Formula | C33H29F3N6O2 |
| Molecular Weight | 598.63 g/mol |
| Exact Mass | 598.23 |
| IUPAC Name | 1-(4-methylphenyl)-3-[3-(1-phenylprop-2-enyl)-5-[2-(2H-tetrazol-5-yl)phenyl]-2-(3,3,3-trifluoropropoxy)phenyl]urea |
| SMILES | C=CC(c1ccccc1)c1cc(-c2ccccc2-c2nn[nH]n2)cc(NC(=O)Nc2ccc(C)cc2)c1OCCC(F)(F)F |
| InChI | InChI=1S/C33H29F3N6O2/c1-3-25(22-9-5-4-6-10-22)28-19-23(26-11-7-8-12-27(26)31-39-41-42-40-31)20-29(30(28)44-18-17-33(34,35)36)38-32(43)37-24-15-13-21(2)14-16-24/h3-16,19-20,25H,1,17-18H2,2H3,(H2,37,38,43)(H,39,40,41,42) |
| InChIKey | XTWADBXUBCCPJK-UHFFFAOYSA-N |
| XLogP | 8.14 |
| TPSA | 104.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.63 |
| LogP ≤ 5 | 8.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|