C31H26N6O2 — CID 146309996
1-[(2S,3R)-2-ethenyl-3-phenyl-5-[2-(2H-tetrazol-5-yl)phenyl]-2,3-dihydro-1-benzofuran-7-yl]-3-(4-methylphenyl)urea (PubChem CID 146309996) has the molecular formula C31H26N6O2 and a molecular weight of 514.59 g/mol. Its IUPAC name is 1-[(2S,3R)-2-ethenyl-3-phenyl-5-[2-(2H-tetrazol-5-yl)phenyl]-2,3-dihydro-1-benzofuran-7-yl]-3-(4-methylphenyl)urea.
| Compound Name | 1-[(2S,3R)-2-ethenyl-3-phenyl-5-[2-(2H-tetrazol-5-yl)phenyl]-2,3-dihydro-1-benzofuran-7-yl]-3-(4-methylphenyl)urea |
|---|---|
| PubChem CID | 146309996 |
| Molecular Formula | C31H26N6O2 |
| Molecular Weight | 514.59 g/mol |
| Exact Mass | 514.21 |
| IUPAC Name | 1-[(2S,3R)-2-ethenyl-3-phenyl-5-[2-(2H-tetrazol-5-yl)phenyl]-2,3-dihydro-1-benzofuran-7-yl]-3-(4-methylphenyl)urea |
| SMILES | C=C[C@@H]1Oc2c(NC(=O)Nc3ccc(C)cc3)cc(-c3ccccc3-c3nn[nH]n3)cc2[C@H]1c1ccccc1 |
| InChI | InChI=1S/C31H26N6O2/c1-3-27-28(20-9-5-4-6-10-20)25-17-21(23-11-7-8-12-24(23)30-34-36-37-35-30)18-26(29(25)39-27)33-31(38)32-22-15-13-19(2)14-16-22/h3-18,27-28H,1H2,2H3,(H2,32,33,38)(H,34,35,36,37)/t27-,28+/m0/s1 |
| InChIKey | APKOMUKVJQRPHO-WUFINQPMSA-N |
| XLogP | 6.57 |
| TPSA | 104.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.59 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|