C30H22ClFN6O2 — CID 146333804
1-(4-chloro-2-fluorophenyl)-3-[5-phenyl-7-[2-(2H-tetrazol-5-yl)phenyl]-2,5-dihydro-1-benzoxepin-9-yl]urea (PubChem CID 146333804) has the molecular formula C30H22ClFN6O2 and a molecular weight of 553.00 g/mol. Its IUPAC name is 1-(4-chloro-2-fluorophenyl)-3-[5-phenyl-7-[2-(2H-tetrazol-5-yl)phenyl]-2,5-dihydro-1-benzoxepin-9-yl]urea.
| Compound Name | 1-(4-chloro-2-fluorophenyl)-3-[5-phenyl-7-[2-(2H-tetrazol-5-yl)phenyl]-2,5-dihydro-1-benzoxepin-9-yl]urea |
|---|---|
| PubChem CID | 146333804 |
| Molecular Formula | C30H22ClFN6O2 |
| Molecular Weight | 553.00 g/mol |
| Exact Mass | 552.15 |
| IUPAC Name | 1-(4-chloro-2-fluorophenyl)-3-[5-phenyl-7-[2-(2H-tetrazol-5-yl)phenyl]-2,5-dihydro-1-benzoxepin-9-yl]urea |
| SMILES | O=C(Nc1ccc(Cl)cc1F)Nc1cc(-c2ccccc2-c2nn[nH]n2)cc2c1OCC=CC2c1ccccc1 |
| InChI | InChI=1S/C30H22ClFN6O2/c31-20-12-13-26(25(32)17-20)33-30(39)34-27-16-19(22-9-4-5-10-23(22)29-35-37-38-36-29)15-24-21(11-6-14-40-28(24)27)18-7-2-1-3-8-18/h1-13,15-17,21H,14H2,(H2,33,34,39)(H,35,36,37,38) |
| InChIKey | MCVHPSZNQFPYRR-UHFFFAOYSA-N |
| XLogP | 7.05 |
| TPSA | 104.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.00 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|