C46H33N5O — CID 121344191
N-[amino(phenyl)methyl]-N'-benzyl-4-(6-cyano-2-dibenzofuran-4-ylcarbazol-9-yl)benzenecarboximidamide (PubChem CID 121344191) has the molecular formula C46H33N5O and a molecular weight of 671.80 g/mol. Its IUPAC name is N-[amino(phenyl)methyl]-N'-benzyl-4-(6-cyano-2-dibenzofuran-4-ylcarbazol-9-yl)benzenecarboximidamide.
| Compound Name | N-[amino(phenyl)methyl]-N'-benzyl-4-(6-cyano-2-dibenzofuran-4-ylcarbazol-9-yl)benzenecarboximidamide |
|---|---|
| PubChem CID | 121344191 |
| Molecular Formula | C46H33N5O |
| Molecular Weight | 671.80 g/mol |
| Exact Mass | 671.27 |
| IUPAC Name | N-[amino(phenyl)methyl]-N'-benzyl-4-(6-cyano-2-dibenzofuran-4-ylcarbazol-9-yl)benzenecarboximidamide |
| SMILES | N#Cc1ccc2c(c1)c1ccc(-c3cccc4c3oc3ccccc34)cc1n2-c1ccc(/C(=N\Cc2ccccc2)NC(N)c2ccccc2)cc1 |
| InChI | InChI=1S/C46H33N5O/c47-28-31-18-25-41-40(26-31)37-24-21-34(36-15-9-16-39-38-14-7-8-17-43(38)52-44(36)39)27-42(37)51(41)35-22-19-33(20-23-35)46(49-29-30-10-3-1-4-11-30)50-45(48)32-12-5-2-6-13-32/h1-27,45H,29,48H2,(H,49,50) |
| InChIKey | QCDAOZSGPWJXTJ-UHFFFAOYSA-N |
| XLogP | 10.42 |
| TPSA | 92.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 671.80 |
| LogP ≤ 5 | 10.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|