C26H38N4O2 — CID 121345680
3-[4-cyclopropyl-5-(4-methylpentyl)-1,2,4-triazol-3-yl]-N-[(2-methoxy-4-methylphenyl)methyl]hex-5-enamide (PubChem CID 121345680) has the molecular formula C26H38N4O2 and a molecular weight of 438.62 g/mol. Its IUPAC name is 3-[4-cyclopropyl-5-(4-methylpentyl)-1,2,4-triazol-3-yl]-N-[(2-methoxy-4-methylphenyl)methyl]hex-5-enamide.
| Compound Name | 3-[4-cyclopropyl-5-(4-methylpentyl)-1,2,4-triazol-3-yl]-N-[(2-methoxy-4-methylphenyl)methyl]hex-5-enamide |
|---|---|
| PubChem CID | 121345680 |
| Molecular Formula | C26H38N4O2 |
| Molecular Weight | 438.62 g/mol |
| Exact Mass | 438.30 |
| IUPAC Name | 3-[4-cyclopropyl-5-(4-methylpentyl)-1,2,4-triazol-3-yl]-N-[(2-methoxy-4-methylphenyl)methyl]hex-5-enamide |
| SMILES | C=CCC(CC(=O)NCc1ccc(C)cc1OC)c1nnc(CCCC(C)C)n1C1CC1 |
| InChI | InChI=1S/C26H38N4O2/c1-6-8-20(16-25(31)27-17-21-12-11-19(4)15-23(21)32-5)26-29-28-24(10-7-9-18(2)3)30(26)22-13-14-22/h6,11-12,15,18,20,22H,1,7-10,13-14,16-17H2,2-5H3,(H,27,31) |
| InChIKey | LWUFJCSOLDZTBN-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.62 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|