C28H40N4O2 — CID 121345749
trans-(1R,2R)-2-[4-cyclopropyl-5-[3-(2-methylpropyl)cyclobutyl]-1,2,4-triazol-3-yl]-N-(2,4-dimethylphenyl)-4-methoxycyclopentane-1-carboxamide (PubChem CID 121345749) has the molecular formula C28H40N4O2 and a molecular weight of 464.65 g/mol. Its IUPAC name is trans-(1R,2R)-2-[4-cyclopropyl-5-[3-(2-methylpropyl)cyclobutyl]-1,2,4-triazol-3-yl]-N-(2,4-dimethylphenyl)-4-methoxycyclopentane-1-carboxamide.
| Compound Name | trans-(1R,2R)-2-[4-cyclopropyl-5-[3-(2-methylpropyl)cyclobutyl]-1,2,4-triazol-3-yl]-N-(2,4-dimethylphenyl)-4-methoxycyclopentane-1-carboxamide |
|---|---|
| PubChem CID | 121345749 |
| Molecular Formula | C28H40N4O2 |
| Molecular Weight | 464.65 g/mol |
| Exact Mass | 464.32 |
| IUPAC Name | trans-(1R,2R)-2-[4-cyclopropyl-5-[3-(2-methylpropyl)cyclobutyl]-1,2,4-triazol-3-yl]-N-(2,4-dimethylphenyl)-4-methoxycyclopentane-1-carboxamide |
| SMILES | COC1C[C@@H](C(=O)Nc2ccc(C)cc2C)[C@H](c2nnc(C3CC(CC(C)C)C3)n2C2CC2)C1 |
| InChI | InChI=1S/C28H40N4O2/c1-16(2)10-19-12-20(13-19)26-30-31-27(32(26)21-7-8-21)23-14-22(34-5)15-24(23)28(33)29-25-9-6-17(3)11-18(25)4/h6,9,11,16,19-24H,7-8,10,12-15H2,1-5H3,(H,29,33)/t19?,20?,22?,23-,24-/m1/s1 |
| InChIKey | BHQKHZFFGKUZEN-GQIDSGHNSA-N |
| XLogP | 5.92 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.65 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |