C28H39N3O2 — CID 162088307
1-[(1S,2S,4R)-2-[4-cyclopropyl-5-[3-(2-methylpropyl)cyclobutyl]-1,2,4-triazol-3-yl]-4-hydroxycyclopentyl]-2-(2,4-dimethylphenyl)ethanone (PubChem CID 162088307) has the molecular formula C28H39N3O2 and a molecular weight of 449.64 g/mol. Its IUPAC name is 1-[(1S,2S,4R)-2-[4-cyclopropyl-5-[3-(2-methylpropyl)cyclobutyl]-1,2,4-triazol-3-yl]-4-hydroxycyclopentyl]-2-(2,4-dimethylphenyl)ethanone.
| Compound Name | 1-[(1S,2S,4R)-2-[4-cyclopropyl-5-[3-(2-methylpropyl)cyclobutyl]-1,2,4-triazol-3-yl]-4-hydroxycyclopentyl]-2-(2,4-dimethylphenyl)ethanone |
|---|---|
| PubChem CID | 162088307 |
| Molecular Formula | C28H39N3O2 |
| Molecular Weight | 449.64 g/mol |
| Exact Mass | 449.30 |
| IUPAC Name | 1-[(1S,2S,4R)-2-[4-cyclopropyl-5-[3-(2-methylpropyl)cyclobutyl]-1,2,4-triazol-3-yl]-4-hydroxycyclopentyl]-2-(2,4-dimethylphenyl)ethanone |
| SMILES | Cc1ccc(CC(=O)[C@H]2C[C@H](O)C[C@@H]2c2nnc(C3CC(CC(C)C)C3)n2C2CC2)c(C)c1 |
| InChI | InChI=1S/C28H39N3O2/c1-16(2)9-19-11-21(12-19)27-29-30-28(31(27)22-7-8-22)25-15-23(32)14-24(25)26(33)13-20-6-5-17(3)10-18(20)4/h5-6,10,16,19,21-25,32H,7-9,11-15H2,1-4H3/t19?,21?,23-,24-,25-/m0/s1 |
| InChIKey | ZDGOQPAFPBIJQA-JXEAHHCRSA-N |
| XLogP | 5.44 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.64 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |