C30H42N4O2 — CID 158956125
1-[(3R,4R)-1-acetyl-4-[4-cyclopropyl-5-[3-(2,2-dimethylpropyl)cyclobutyl]-1,2,4-triazol-3-yl]pyrrolidin-3-yl]-2-(2,4-dimethylphenyl)ethanone (PubChem CID 158956125) has the molecular formula C30H42N4O2 and a molecular weight of 490.69 g/mol. Its IUPAC name is 1-[(3R,4R)-1-acetyl-4-[4-cyclopropyl-5-[3-(2,2-dimethylpropyl)cyclobutyl]-1,2,4-triazol-3-yl]pyrrolidin-3-yl]-2-(2,4-dimethylphenyl)ethanone.
| Compound Name | 1-[(3R,4R)-1-acetyl-4-[4-cyclopropyl-5-[3-(2,2-dimethylpropyl)cyclobutyl]-1,2,4-triazol-3-yl]pyrrolidin-3-yl]-2-(2,4-dimethylphenyl)ethanone |
|---|---|
| PubChem CID | 158956125 |
| Molecular Formula | C30H42N4O2 |
| Molecular Weight | 490.69 g/mol |
| Exact Mass | 490.33 |
| IUPAC Name | 1-[(3R,4R)-1-acetyl-4-[4-cyclopropyl-5-[3-(2,2-dimethylpropyl)cyclobutyl]-1,2,4-triazol-3-yl]pyrrolidin-3-yl]-2-(2,4-dimethylphenyl)ethanone |
| SMILES | CC(=O)N1C[C@H](C(=O)Cc2ccc(C)cc2C)[C@@H](c2nnc(C3CC(CC(C)(C)C)C3)n2C2CC2)C1 |
| InChI | InChI=1S/C30H42N4O2/c1-18-7-8-22(19(2)11-18)14-27(36)25-16-33(20(3)35)17-26(25)29-32-31-28(34(29)24-9-10-24)23-12-21(13-23)15-30(4,5)6/h7-8,11,21,23-26H,9-10,12-17H2,1-6H3/t21?,23?,25-,26-/m0/s1 |
| InChIKey | JMAJKZBOIHSEEC-RTLVRTHGSA-N |
| XLogP | 5.53 |
| TPSA | 68.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.69 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |