C27H36F3N3O — CID 149244199
(4R)-4-[4-cyclopropyl-5-[3-(2-methylpropyl)cyclobutyl]-1,2,4-triazol-3-yl]-1-(2,4-dimethylphenyl)-6,6,6-trifluorohexan-2-one (PubChem CID 149244199) has the molecular formula C27H36F3N3O and a molecular weight of 475.60 g/mol. Its IUPAC name is (4R)-4-[4-cyclopropyl-5-[3-(2-methylpropyl)cyclobutyl]-1,2,4-triazol-3-yl]-1-(2,4-dimethylphenyl)-6,6,6-trifluorohexan-2-one.
| Compound Name | (4R)-4-[4-cyclopropyl-5-[3-(2-methylpropyl)cyclobutyl]-1,2,4-triazol-3-yl]-1-(2,4-dimethylphenyl)-6,6,6-trifluorohexan-2-one |
|---|---|
| PubChem CID | 149244199 |
| Molecular Formula | C27H36F3N3O |
| Molecular Weight | 475.60 g/mol |
| Exact Mass | 475.28 |
| IUPAC Name | (4R)-4-[4-cyclopropyl-5-[3-(2-methylpropyl)cyclobutyl]-1,2,4-triazol-3-yl]-1-(2,4-dimethylphenyl)-6,6,6-trifluorohexan-2-one |
| SMILES | Cc1ccc(CC(=O)C[C@H](CC(F)(F)F)c2nnc(C3CC(CC(C)C)C3)n2C2CC2)c(C)c1 |
| InChI | InChI=1S/C27H36F3N3O/c1-16(2)9-19-11-21(12-19)25-31-32-26(33(25)23-7-8-23)22(15-27(28,29)30)14-24(34)13-20-6-5-17(3)10-18(20)4/h5-6,10,16,19,21-23H,7-9,11-15H2,1-4H3/t19?,21?,22-/m1/s1 |
| InChIKey | XMTWCJFMWDGMJB-KITAHSCOSA-N |
| XLogP | 7.01 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.60 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |