C23H23FN2O4 — CID 121347530
2-[2-[[3-amino-5-[3-(1-amino-2-hydroxyethyl)phenyl]-2-fluorophenyl]methoxy]phenyl]acetic acid (PubChem CID 121347530) has the molecular formula C23H23FN2O4 and a molecular weight of 410.45 g/mol. Its IUPAC name is 2-[2-[[3-amino-5-[3-(1-amino-2-hydroxyethyl)phenyl]-2-fluorophenyl]methoxy]phenyl]acetic acid.
| Compound Name | 2-[2-[[3-amino-5-[3-(1-amino-2-hydroxyethyl)phenyl]-2-fluorophenyl]methoxy]phenyl]acetic acid |
|---|---|
| PubChem CID | 121347530 |
| Molecular Formula | C23H23FN2O4 |
| Molecular Weight | 410.45 g/mol |
| Exact Mass | 410.16 |
| IUPAC Name | 2-[2-[[3-amino-5-[3-(1-amino-2-hydroxyethyl)phenyl]-2-fluorophenyl]methoxy]phenyl]acetic acid |
| SMILES | Nc1cc(-c2cccc(C(N)CO)c2)cc(COc2ccccc2CC(=O)O)c1F |
| InChI | InChI=1S/C23H23FN2O4/c24-23-18(13-30-21-7-2-1-4-16(21)11-22(28)29)9-17(10-19(23)25)14-5-3-6-15(8-14)20(26)12-27/h1-10,20,27H,11-13,25-26H2,(H,28,29) |
| InChIKey | MLGXIDKVEPMQII-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 118.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.45 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|