C30H34N2O4 — CID 172524321
[2-[[3-[3-[(1R)-1-amino-2-hydroxyethyl]phenyl]-5-(2-azaspiro[3.4]octan-2-yl)phenyl]methoxy]phenyl]methyl formate (PubChem CID 172524321) has the molecular formula C30H34N2O4 and a molecular weight of 486.61 g/mol. Its IUPAC name is [2-[[3-[3-[(1R)-1-amino-2-hydroxyethyl]phenyl]-5-(2-azaspiro[3.4]octan-2-yl)phenyl]methoxy]phenyl]methyl formate.
| Compound Name | [2-[[3-[3-[(1R)-1-amino-2-hydroxyethyl]phenyl]-5-(2-azaspiro[3.4]octan-2-yl)phenyl]methoxy]phenyl]methyl formate |
|---|---|
| PubChem CID | 172524321 |
| Molecular Formula | C30H34N2O4 |
| Molecular Weight | 486.61 g/mol |
| Exact Mass | 486.25 |
| IUPAC Name | [2-[[3-[3-[(1R)-1-amino-2-hydroxyethyl]phenyl]-5-(2-azaspiro[3.4]octan-2-yl)phenyl]methoxy]phenyl]methyl formate |
| SMILES | N[C@@H](CO)c1cccc(-c2cc(COc3ccccc3COC=O)cc(N3CC4(CCCC4)C3)c2)c1 |
| InChI | InChI=1S/C30H34N2O4/c31-28(16-33)24-8-5-7-23(14-24)26-12-22(17-36-29-9-2-1-6-25(29)18-35-21-34)13-27(15-26)32-19-30(20-32)10-3-4-11-30/h1-2,5-9,12-15,21,28,33H,3-4,10-11,16-20,31H2/t28-/m0/s1 |
| InChIKey | NANBZBNHUKTFKH-NDEPHWFRSA-N |
| XLogP | 4.98 |
| TPSA | 85.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.61 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|