C29H32N2O4 — CID 172524562
[2-[[3-[3-[(1S)-1-aminoethyl]phenyl]-5-(4-oxa-7-azaspiro[2.5]octan-7-yl)phenyl]methoxy]phenyl]methyl formate (PubChem CID 172524562) has the molecular formula C29H32N2O4 and a molecular weight of 472.59 g/mol. Its IUPAC name is [2-[[3-[3-[(1S)-1-aminoethyl]phenyl]-5-(4-oxa-7-azaspiro[2.5]octan-7-yl)phenyl]methoxy]phenyl]methyl formate.
| Compound Name | [2-[[3-[3-[(1S)-1-aminoethyl]phenyl]-5-(4-oxa-7-azaspiro[2.5]octan-7-yl)phenyl]methoxy]phenyl]methyl formate |
|---|---|
| PubChem CID | 172524562 |
| Molecular Formula | C29H32N2O4 |
| Molecular Weight | 472.59 g/mol |
| Exact Mass | 472.24 |
| IUPAC Name | [2-[[3-[3-[(1S)-1-aminoethyl]phenyl]-5-(4-oxa-7-azaspiro[2.5]octan-7-yl)phenyl]methoxy]phenyl]methyl formate |
| SMILES | C[C@H](N)c1cccc(-c2cc(COc3ccccc3COC=O)cc(N3CCOC4(CC4)C3)c2)c1 |
| InChI | InChI=1S/C29H32N2O4/c1-21(30)23-6-4-7-24(15-23)26-13-22(17-34-28-8-3-2-5-25(28)18-33-20-32)14-27(16-26)31-11-12-35-29(19-31)9-10-29/h2-8,13-16,20-21H,9-12,17-19,30H2,1H3/t21-/m0/s1 |
| InChIKey | RMJBIAPFHWHYMV-NRFANRHFSA-N |
| XLogP | 4.99 |
| TPSA | 74.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.59 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|