C14H18N2 — CID 121348828
5-piperidin-1-yl-3,4-dihydroisoquinoline (PubChem CID 121348828) has the molecular formula C14H18N2 and a molecular weight of 214.31 g/mol. Its IUPAC name is 5-piperidin-1-yl-3,4-dihydroisoquinoline.
| Compound Name | 5-piperidin-1-yl-3,4-dihydroisoquinoline |
|---|---|
| PubChem CID | 121348828 |
| Molecular Formula | C14H18N2 |
| Molecular Weight | 214.31 g/mol |
| Exact Mass | 214.15 |
| IUPAC Name | 5-piperidin-1-yl-3,4-dihydroisoquinoline |
| SMILES | C1=NCCc2c1cccc2N1CCCCC1 |
| InChI | InChI=1S/C14H18N2/c1-2-9-16(10-3-1)14-6-4-5-12-11-15-8-7-13(12)14/h4-6,11H,1-3,7-10H2 |
| InChIKey | IJDSYTSVSRGQDM-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.31 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |