C22H32O5 — CID 121349096
2-[2-(1-hydroxyethyl)-1-phenylhexoxy]carbonylcyclohexane-1-carboxylic acid (PubChem CID 121349096) has the molecular formula C22H32O5 and a molecular weight of 376.49 g/mol. Its IUPAC name is 2-[2-(1-hydroxyethyl)-1-phenylhexoxy]carbonylcyclohexane-1-carboxylic acid.
| Compound Name | 2-[2-(1-hydroxyethyl)-1-phenylhexoxy]carbonylcyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 121349096 |
| Molecular Formula | C22H32O5 |
| Molecular Weight | 376.49 g/mol |
| Exact Mass | 376.22 |
| IUPAC Name | 2-[2-(1-hydroxyethyl)-1-phenylhexoxy]carbonylcyclohexane-1-carboxylic acid |
| SMILES | CCCCC(C(C)O)C(OC(=O)C1CCCCC1C(=O)O)c1ccccc1 |
| InChI | InChI=1S/C22H32O5/c1-3-4-12-17(15(2)23)20(16-10-6-5-7-11-16)27-22(26)19-14-9-8-13-18(19)21(24)25/h5-7,10-11,15,17-20,23H,3-4,8-9,12-14H2,1-2H3,(H,24,25) |
| InChIKey | JFWPVJKLSVVQJP-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.49 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |