C30H40N6O5S2 — CID 121349220
2-N-[(2R)-2,5-dimethyl-4-[1-(2-methylsulfonylethyl)piperidin-4-yl]-2,3-dihydro-1-benzofuran-7-yl]-4-N-(2-propan-2-ylsulfonylphenyl)-1,3,5-triazine-2,4-diamine (PubChem CID 121349220) has the molecular formula C30H40N6O5S2 and a molecular weight of 628.82 g/mol. Its IUPAC name is 2-N-[(2R)-2,5-dimethyl-4-[1-(2-methylsulfonylethyl)piperidin-4-yl]-2,3-dihydro-1-benzofuran-7-yl]-4-N-(2-propan-2-ylsulfonylphenyl)-1,3,5-triazine-2,4-diamine.
| Compound Name | 2-N-[(2R)-2,5-dimethyl-4-[1-(2-methylsulfonylethyl)piperidin-4-yl]-2,3-dihydro-1-benzofuran-7-yl]-4-N-(2-propan-2-ylsulfonylphenyl)-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 121349220 |
| Molecular Formula | C30H40N6O5S2 |
| Molecular Weight | 628.82 g/mol |
| Exact Mass | 628.25 |
| IUPAC Name | 2-N-[(2R)-2,5-dimethyl-4-[1-(2-methylsulfonylethyl)piperidin-4-yl]-2,3-dihydro-1-benzofuran-7-yl]-4-N-(2-propan-2-ylsulfonylphenyl)-1,3,5-triazine-2,4-diamine |
| SMILES | Cc1cc(Nc2ncnc(Nc3ccccc3S(=O)(=O)C(C)C)n2)c2c(c1C1CCN(CCS(C)(=O)=O)CC1)C[C@@H](C)O2 |
| InChI | InChI=1S/C30H40N6O5S2/c1-19(2)43(39,40)26-9-7-6-8-24(26)33-29-31-18-32-30(35-29)34-25-16-20(3)27(23-17-21(4)41-28(23)25)22-10-12-36(13-11-22)14-15-42(5,37)38/h6-9,16,18-19,21-22H,10-15,17H2,1-5H3,(H2,31,32,33,34,35)/t21-/m1/s1 |
| InChIKey | OUZJFCSTMDLVFK-OAQYLSRUSA-N |
| XLogP | 4.40 |
| TPSA | 143.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.82 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |