C15H14ClN7O2 — CID 121351482
3-amino-6-chloro-N-[(2-methoxyphenyl)methyl]-5-(triazol-2-yl)pyrazine-2-carboxamide (PubChem CID 121351482) has the molecular formula C15H14ClN7O2 and a molecular weight of 359.78 g/mol. Its IUPAC name is 3-amino-6-chloro-N-[(2-methoxyphenyl)methyl]-5-(triazol-2-yl)pyrazine-2-carboxamide.
| Compound Name | 3-amino-6-chloro-N-[(2-methoxyphenyl)methyl]-5-(triazol-2-yl)pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 121351482 |
| Molecular Formula | C15H14ClN7O2 |
| Molecular Weight | 359.78 g/mol |
| Exact Mass | 359.09 |
| IUPAC Name | 3-amino-6-chloro-N-[(2-methoxyphenyl)methyl]-5-(triazol-2-yl)pyrazine-2-carboxamide |
| SMILES | COc1ccccc1CNC(=O)c1nc(Cl)c(-n2nccn2)nc1N |
| InChI | InChI=1S/C15H14ClN7O2/c1-25-10-5-3-2-4-9(10)8-18-15(24)11-13(17)22-14(12(16)21-11)23-19-6-7-20-23/h2-7H,8H2,1H3,(H2,17,22)(H,18,24) |
| InChIKey | KYRQZMAUSRZQMP-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 120.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.78 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |