C17H14ClN7O — CID 147017328
3-amino-6-chloro-N-(1H-inden-2-ylmethyl)-5-(triazol-2-yl)pyrazine-2-carboxamide (PubChem CID 147017328) has the molecular formula C17H14ClN7O and a molecular weight of 367.80 g/mol. Its IUPAC name is 3-amino-6-chloro-N-(1H-inden-2-ylmethyl)-5-(triazol-2-yl)pyrazine-2-carboxamide.
| Compound Name | 3-amino-6-chloro-N-(1H-inden-2-ylmethyl)-5-(triazol-2-yl)pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 147017328 |
| Molecular Formula | C17H14ClN7O |
| Molecular Weight | 367.80 g/mol |
| Exact Mass | 367.09 |
| IUPAC Name | 3-amino-6-chloro-N-(1H-inden-2-ylmethyl)-5-(triazol-2-yl)pyrazine-2-carboxamide |
| SMILES | Nc1nc(-n2nccn2)c(Cl)nc1C(=O)NCC1=Cc2ccccc2C1 |
| InChI | InChI=1S/C17H14ClN7O/c18-14-16(25-21-5-6-22-25)24-15(19)13(23-14)17(26)20-9-10-7-11-3-1-2-4-12(11)8-10/h1-7H,8-9H2,(H2,19,24)(H,20,26) |
| InChIKey | AVAIVNLYTPBVJN-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 111.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.80 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |