C25H26F3N5O2 — CID 121352862
N-[3-[6-amino-5-[2-(2-fluoroethylamino)ethoxy]pyrimidin-4-yl]-5-fluoro-2-methylphenyl]-4-cyclopropyl-2-fluorobenzamide (PubChem CID 121352862) has the molecular formula C25H26F3N5O2 and a molecular weight of 485.51 g/mol. Its IUPAC name is N-[3-[6-amino-5-[2-(2-fluoroethylamino)ethoxy]pyrimidin-4-yl]-5-fluoro-2-methylphenyl]-4-cyclopropyl-2-fluorobenzamide.
| Compound Name | N-[3-[6-amino-5-[2-(2-fluoroethylamino)ethoxy]pyrimidin-4-yl]-5-fluoro-2-methylphenyl]-4-cyclopropyl-2-fluorobenzamide |
|---|---|
| PubChem CID | 121352862 |
| Molecular Formula | C25H26F3N5O2 |
| Molecular Weight | 485.51 g/mol |
| Exact Mass | 485.20 |
| IUPAC Name | N-[3-[6-amino-5-[2-(2-fluoroethylamino)ethoxy]pyrimidin-4-yl]-5-fluoro-2-methylphenyl]-4-cyclopropyl-2-fluorobenzamide |
| SMILES | Cc1c(NC(=O)c2ccc(C3CC3)cc2F)cc(F)cc1-c1ncnc(N)c1OCCNCCF |
| InChI | InChI=1S/C25H26F3N5O2/c1-14-19(22-23(24(29)32-13-31-22)35-9-8-30-7-6-26)11-17(27)12-21(14)33-25(34)18-5-4-16(10-20(18)28)15-2-3-15/h4-5,10-13,15,30H,2-3,6-9H2,1H3,(H,33,34)(H2,29,31,32) |
| InChIKey | BUJDUXDRANLQNO-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 102.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.51 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|