C24H24F2N6O3 — CID 176844976
N-[3-[6-amino-5-[2-[methyl(nitroso)amino]ethoxy]pyrimidin-4-yl]-5-fluoro-2-methylphenyl]-4-cyclopropyl-2-fluorobenzamide (PubChem CID 176844976) has the molecular formula C24H24F2N6O3 and a molecular weight of 482.49 g/mol. Its IUPAC name is N-[3-[6-amino-5-[2-[methyl(nitroso)amino]ethoxy]pyrimidin-4-yl]-5-fluoro-2-methylphenyl]-4-cyclopropyl-2-fluorobenzamide.
| Compound Name | N-[3-[6-amino-5-[2-[methyl(nitroso)amino]ethoxy]pyrimidin-4-yl]-5-fluoro-2-methylphenyl]-4-cyclopropyl-2-fluorobenzamide |
|---|---|
| PubChem CID | 176844976 |
| Molecular Formula | C24H24F2N6O3 |
| Molecular Weight | 482.49 g/mol |
| Exact Mass | 482.19 |
| IUPAC Name | N-[3-[6-amino-5-[2-[methyl(nitroso)amino]ethoxy]pyrimidin-4-yl]-5-fluoro-2-methylphenyl]-4-cyclopropyl-2-fluorobenzamide |
| SMILES | Cc1c(NC(=O)c2ccc(C3CC3)cc2F)cc(F)cc1-c1ncnc(N)c1OCCN(C)N=O |
| InChI | InChI=1S/C24H24F2N6O3/c1-13-18(21-22(23(27)29-12-28-21)35-8-7-32(2)31-34)10-16(25)11-20(13)30-24(33)17-6-5-15(9-19(17)26)14-3-4-14/h5-6,9-12,14H,3-4,7-8H2,1-2H3,(H,30,33)(H2,27,28,29) |
| InChIKey | ZADFYWYBPHQJSW-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 122.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.49 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|