C23H30F2N6O — CID 121353524
(7R)-N,N-diethyl-7-[[5-fluoro-2-(5-fluoro-1H-pyrrolo[2,3-b]pyridin-3-yl)pyrimidin-4-yl]amino]octanamide (PubChem CID 121353524) has the molecular formula C23H30F2N6O and a molecular weight of 444.53 g/mol. Its IUPAC name is (7R)-N,N-diethyl-7-[[5-fluoro-2-(5-fluoro-1H-pyrrolo[2,3-b]pyridin-3-yl)pyrimidin-4-yl]amino]octanamide.
| Compound Name | (7R)-N,N-diethyl-7-[[5-fluoro-2-(5-fluoro-1H-pyrrolo[2,3-b]pyridin-3-yl)pyrimidin-4-yl]amino]octanamide |
|---|---|
| PubChem CID | 121353524 |
| Molecular Formula | C23H30F2N6O |
| Molecular Weight | 444.53 g/mol |
| Exact Mass | 444.24 |
| IUPAC Name | (7R)-N,N-diethyl-7-[[5-fluoro-2-(5-fluoro-1H-pyrrolo[2,3-b]pyridin-3-yl)pyrimidin-4-yl]amino]octanamide |
| SMILES | CCN(CC)C(=O)CCCCC[C@@H](C)Nc1nc(-c2c[nH]c3ncc(F)cc23)ncc1F |
| InChI | InChI=1S/C23H30F2N6O/c1-4-31(5-2)20(32)10-8-6-7-9-15(3)29-23-19(25)14-28-22(30-23)18-13-27-21-17(18)11-16(24)12-26-21/h11-15H,4-10H2,1-3H3,(H,26,27)(H,28,29,30)/t15-/m1/s1 |
| InChIKey | AXPXMTQSLPCXPO-OAHLLOKOSA-N |
| XLogP | 4.92 |
| TPSA | 86.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.53 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|