C21H26F2N6O2 — CID 138646413
[(4R)-4-[[5-fluoro-2-(5-fluoro-1H-pyrrolo[2,3-b]pyridin-3-yl)pyrimidin-4-yl]amino]pentyl] N,N-diethylcarbamate (PubChem CID 138646413) has the molecular formula C21H26F2N6O2 and a molecular weight of 432.48 g/mol. Its IUPAC name is [(4R)-4-[[5-fluoro-2-(5-fluoro-1H-pyrrolo[2,3-b]pyridin-3-yl)pyrimidin-4-yl]amino]pentyl] N,N-diethylcarbamate.
| Compound Name | [(4R)-4-[[5-fluoro-2-(5-fluoro-1H-pyrrolo[2,3-b]pyridin-3-yl)pyrimidin-4-yl]amino]pentyl] N,N-diethylcarbamate |
|---|---|
| PubChem CID | 138646413 |
| Molecular Formula | C21H26F2N6O2 |
| Molecular Weight | 432.48 g/mol |
| Exact Mass | 432.21 |
| IUPAC Name | [(4R)-4-[[5-fluoro-2-(5-fluoro-1H-pyrrolo[2,3-b]pyridin-3-yl)pyrimidin-4-yl]amino]pentyl] N,N-diethylcarbamate |
| SMILES | CCN(CC)C(=O)OCCC[C@@H](C)Nc1nc(-c2c[nH]c3ncc(F)cc23)ncc1F |
| InChI | InChI=1S/C21H26F2N6O2/c1-4-29(5-2)21(30)31-8-6-7-13(3)27-20-17(23)12-26-19(28-20)16-11-25-18-15(16)9-14(22)10-24-18/h9-13H,4-8H2,1-3H3,(H,24,25)(H,26,27,28)/t13-/m1/s1 |
| InChIKey | HTJCELVQUUBUQU-CYBMUJFWSA-N |
| XLogP | 4.36 |
| TPSA | 96.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.48 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|