C19H22N6O3 — CID 121358097
(9S)-5-N-[(2S)-1-hydroxypropan-2-yl]-8-N-pyridin-2-yl-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-5,8-dicarboxamide (PubChem CID 121358097) has the molecular formula C19H22N6O3 and a molecular weight of 382.42 g/mol. Its IUPAC name is (9S)-5-N-[(2S)-1-hydroxypropan-2-yl]-8-N-pyridin-2-yl-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-5,8-dicarboxamide.
| Compound Name | (9S)-5-N-[(2S)-1-hydroxypropan-2-yl]-8-N-pyridin-2-yl-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-5,8-dicarboxamide |
|---|---|
| PubChem CID | 121358097 |
| Molecular Formula | C19H22N6O3 |
| Molecular Weight | 382.42 g/mol |
| Exact Mass | 382.18 |
| IUPAC Name | (9S)-5-N-[(2S)-1-hydroxypropan-2-yl]-8-N-pyridin-2-yl-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-5,8-dicarboxamide |
| SMILES | C[C@@H](CO)NC(=O)c1ccc2c(n1)N(C(=O)Nc1ccccn1)[C@H]1CCN2C1 |
| InChI | InChI=1S/C19H22N6O3/c1-12(11-26)21-18(27)14-5-6-15-17(22-14)25(13-7-9-24(15)10-13)19(28)23-16-4-2-3-8-20-16/h2-6,8,12-13,26H,7,9-11H2,1H3,(H,21,27)(H,20,23,28)/t12-,13-/m0/s1 |
| InChIKey | VIORCNDKXKZTMF-STQMWFEESA-N |
| XLogP | 1.22 |
| TPSA | 110.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.42 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |