C16H16N6O2 — CID 121358083
8-N-pyridin-2-yl-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-5,8-dicarboxamide (PubChem CID 121358083) has the molecular formula C16H16N6O2 and a molecular weight of 324.34 g/mol. Its IUPAC name is 8-N-pyridin-2-yl-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-5,8-dicarboxamide.
| Compound Name | 8-N-pyridin-2-yl-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-5,8-dicarboxamide |
|---|---|
| PubChem CID | 121358083 |
| Molecular Formula | C16H16N6O2 |
| Molecular Weight | 324.34 g/mol |
| Exact Mass | 324.13 |
| IUPAC Name | 8-N-pyridin-2-yl-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-5,8-dicarboxamide |
| SMILES | NC(=O)c1ccc2c(n1)N(C(=O)Nc1ccccn1)C1CCN2C1 |
| InChI | InChI=1S/C16H16N6O2/c17-14(23)11-4-5-12-15(19-11)22(10-6-8-21(12)9-10)16(24)20-13-3-1-2-7-18-13/h1-5,7,10H,6,8-9H2,(H2,17,23)(H,18,20,24) |
| InChIKey | YTRSWOKKEFTZSY-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 104.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.34 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |