C25H27N7O — CID 118107292
5-(6-piperidin-1-yl-3-pyridinyl)-N-pyridin-2-yl-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide (PubChem CID 118107292) has the molecular formula C25H27N7O and a molecular weight of 441.54 g/mol. Its IUPAC name is 5-(6-piperidin-1-yl-3-pyridinyl)-N-pyridin-2-yl-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide.
| Compound Name | 5-(6-piperidin-1-yl-3-pyridinyl)-N-pyridin-2-yl-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide |
|---|---|
| PubChem CID | 118107292 |
| Molecular Formula | C25H27N7O |
| Molecular Weight | 441.54 g/mol |
| Exact Mass | 441.23 |
| IUPAC Name | 5-(6-piperidin-1-yl-3-pyridinyl)-N-pyridin-2-yl-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide |
| SMILES | O=C(Nc1ccccn1)N1c2nc(-c3ccc(N4CCCCC4)nc3)ccc2N2CCC1C2 |
| InChI | InChI=1S/C25H27N7O/c33-25(29-22-6-2-3-12-26-22)32-19-11-15-31(17-19)21-9-8-20(28-24(21)32)18-7-10-23(27-16-18)30-13-4-1-5-14-30/h2-3,6-10,12,16,19H,1,4-5,11,13-15,17H2,(H,26,29,33) |
| InChIKey | JGNWLSWIHHPGHC-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 77.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.54 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |