C22H22FN7O — CID 121350702
(9S)-5-[6-(dimethylamino)-5-fluoro-3-pyridinyl]-N-pyridin-2-yl-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide (PubChem CID 121350702) has the molecular formula C22H22FN7O and a molecular weight of 419.46 g/mol. Its IUPAC name is (9S)-5-[6-(dimethylamino)-5-fluoro-3-pyridinyl]-N-pyridin-2-yl-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide.
| Compound Name | (9S)-5-[6-(dimethylamino)-5-fluoro-3-pyridinyl]-N-pyridin-2-yl-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide |
|---|---|
| PubChem CID | 121350702 |
| Molecular Formula | C22H22FN7O |
| Molecular Weight | 419.46 g/mol |
| Exact Mass | 419.19 |
| IUPAC Name | (9S)-5-[6-(dimethylamino)-5-fluoro-3-pyridinyl]-N-pyridin-2-yl-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide |
| SMILES | CN(C)c1ncc(-c2ccc3c(n2)N(C(=O)Nc2ccccn2)[C@H]2CCN3C2)cc1F |
| InChI | InChI=1S/C22H22FN7O/c1-28(2)20-16(23)11-14(12-25-20)17-6-7-18-21(26-17)30(15-8-10-29(18)13-15)22(31)27-19-5-3-4-9-24-19/h3-7,9,11-12,15H,8,10,13H2,1-2H3,(H,24,27,31)/t15-/m0/s1 |
| InChIKey | ULBHVMLFPQMUTL-HNNXBMFYSA-N |
| XLogP | 3.37 |
| TPSA | 77.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.46 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |