C20H20N8O — CID 163685224
(9R)-5-[2-(methylamino)-4-pyridinyl]-N-pyrazin-2-yl-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide (PubChem CID 163685224) has the molecular formula C20H20N8O and a molecular weight of 388.44 g/mol. Its IUPAC name is (9R)-5-[2-(methylamino)-4-pyridinyl]-N-pyrazin-2-yl-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide.
| Compound Name | (9R)-5-[2-(methylamino)-4-pyridinyl]-N-pyrazin-2-yl-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide |
|---|---|
| PubChem CID | 163685224 |
| Molecular Formula | C20H20N8O |
| Molecular Weight | 388.44 g/mol |
| Exact Mass | 388.18 |
| IUPAC Name | (9R)-5-[2-(methylamino)-4-pyridinyl]-N-pyrazin-2-yl-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide |
| SMILES | CNc1cc(-c2ccc3c(n2)N(C(=O)Nc2cnccn2)[C@@H]2CCN3C2)ccn1 |
| InChI | InChI=1S/C20H20N8O/c1-21-17-10-13(4-6-23-17)15-2-3-16-19(25-15)28(14-5-9-27(16)12-14)20(29)26-18-11-22-7-8-24-18/h2-4,6-8,10-11,14H,5,9,12H2,1H3,(H,21,23)(H,24,26,29)/t14-/m1/s1 |
| InChIKey | JOHIHEYAIQGTQD-CQSZACIVSA-N |
| XLogP | 2.61 |
| TPSA | 99.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.44 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |