C20H19N7O — CID 118969301
(9S)-5-(2-methyl-4-pyridinyl)-N-pyrimidin-4-yl-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide (PubChem CID 118969301) has the molecular formula C20H19N7O and a molecular weight of 373.42 g/mol. Its IUPAC name is (9S)-5-(2-methyl-4-pyridinyl)-N-pyrimidin-4-yl-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide.
| Compound Name | (9S)-5-(2-methyl-4-pyridinyl)-N-pyrimidin-4-yl-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide |
|---|---|
| PubChem CID | 118969301 |
| Molecular Formula | C20H19N7O |
| Molecular Weight | 373.42 g/mol |
| Exact Mass | 373.17 |
| IUPAC Name | (9S)-5-(2-methyl-4-pyridinyl)-N-pyrimidin-4-yl-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide |
| SMILES | Cc1cc(-c2ccc3c(n2)N(C(=O)Nc2ccncn2)[C@H]2CCN3C2)ccn1 |
| InChI | InChI=1S/C20H19N7O/c1-13-10-14(4-8-22-13)16-2-3-17-19(24-16)27(15-6-9-26(17)11-15)20(28)25-18-5-7-21-12-23-18/h2-5,7-8,10,12,15H,6,9,11H2,1H3,(H,21,23,25,28)/t15-/m0/s1 |
| InChIKey | TVMMZOSPBBFPJD-HNNXBMFYSA-N |
| XLogP | 2.87 |
| TPSA | 87.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.42 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |