C20H21N7O — CID 140675798
N-(1-methylpyrazol-3-yl)-5-(2-methyl-4-pyridinyl)-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide (PubChem CID 140675798) has the molecular formula C20H21N7O and a molecular weight of 375.44 g/mol. Its IUPAC name is N-(1-methylpyrazol-3-yl)-5-(2-methyl-4-pyridinyl)-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide.
| Compound Name | N-(1-methylpyrazol-3-yl)-5-(2-methyl-4-pyridinyl)-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide |
|---|---|
| PubChem CID | 140675798 |
| Molecular Formula | C20H21N7O |
| Molecular Weight | 375.44 g/mol |
| Exact Mass | 375.18 |
| IUPAC Name | N-(1-methylpyrazol-3-yl)-5-(2-methyl-4-pyridinyl)-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide |
| SMILES | Cc1cc(-c2ccc3c(n2)N(C(=O)Nc2ccn(C)n2)C2CCN3C2)ccn1 |
| InChI | InChI=1S/C20H21N7O/c1-13-11-14(5-8-21-13)16-3-4-17-19(22-16)27(15-6-10-26(17)12-15)20(28)23-18-7-9-25(2)24-18/h3-5,7-9,11,15H,6,10,12H2,1-2H3,(H,23,24,28) |
| InChIKey | JRPNYMHRHPRSBN-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 79.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.44 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |