C25H24N8O — CID 121359655
N-[4-(1-methylpyrazol-3-yl)-2-pyridinyl]-5-(2-methyl-4-pyridinyl)-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide (PubChem CID 121359655) has the molecular formula C25H24N8O and a molecular weight of 452.52 g/mol. Its IUPAC name is N-[4-(1-methylpyrazol-3-yl)-2-pyridinyl]-5-(2-methyl-4-pyridinyl)-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide.
| Compound Name | N-[4-(1-methylpyrazol-3-yl)-2-pyridinyl]-5-(2-methyl-4-pyridinyl)-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide |
|---|---|
| PubChem CID | 121359655 |
| Molecular Formula | C25H24N8O |
| Molecular Weight | 452.52 g/mol |
| Exact Mass | 452.21 |
| IUPAC Name | N-[4-(1-methylpyrazol-3-yl)-2-pyridinyl]-5-(2-methyl-4-pyridinyl)-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide |
| SMILES | Cc1cc(-c2ccc3c(n2)N(C(=O)Nc2cc(-c4ccn(C)n4)ccn2)C2CCN3C2)ccn1 |
| InChI | InChI=1S/C25H24N8O/c1-16-13-17(5-9-26-16)20-3-4-22-24(28-20)33(19-7-12-32(22)15-19)25(34)29-23-14-18(6-10-27-23)21-8-11-31(2)30-21/h3-6,8-11,13-14,19H,7,12,15H2,1-2H3,(H,27,29,34) |
| InChIKey | NCLADOMHGLMVTG-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 92.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.52 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |