C23H21N9O — CID 121350718
5-(2-methyl-4-pyridinyl)-N-[4-(1H-1,2,4-triazol-5-yl)-2-pyridinyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide (PubChem CID 121350718) has the molecular formula C23H21N9O and a molecular weight of 439.48 g/mol. Its IUPAC name is 5-(2-methyl-4-pyridinyl)-N-[4-(1H-1,2,4-triazol-5-yl)-2-pyridinyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide.
| Compound Name | 5-(2-methyl-4-pyridinyl)-N-[4-(1H-1,2,4-triazol-5-yl)-2-pyridinyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide |
|---|---|
| PubChem CID | 121350718 |
| Molecular Formula | C23H21N9O |
| Molecular Weight | 439.48 g/mol |
| Exact Mass | 439.19 |
| IUPAC Name | 5-(2-methyl-4-pyridinyl)-N-[4-(1H-1,2,4-triazol-5-yl)-2-pyridinyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide |
| SMILES | Cc1cc(-c2ccc3c(n2)N(C(=O)Nc2cc(-c4ncn[nH]4)ccn2)C2CCN3C2)ccn1 |
| InChI | InChI=1S/C23H21N9O/c1-14-10-15(4-7-24-14)18-2-3-19-22(28-18)32(17-6-9-31(19)12-17)23(33)29-20-11-16(5-8-25-20)21-26-13-27-30-21/h2-5,7-8,10-11,13,17H,6,9,12H2,1H3,(H,25,29,33)(H,26,27,30) |
| InChIKey | ITTNFCNQQFDFKH-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 115.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.48 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |