C23H25N7O — CID 118106992
(9S)-5-(2-methyl-4-pyridinyl)-N-(6-propan-2-ylpyrazin-2-yl)-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide (PubChem CID 118106992) has the molecular formula C23H25N7O and a molecular weight of 415.50 g/mol. Its IUPAC name is (9S)-5-(2-methyl-4-pyridinyl)-N-(6-propan-2-ylpyrazin-2-yl)-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide.
| Compound Name | (9S)-5-(2-methyl-4-pyridinyl)-N-(6-propan-2-ylpyrazin-2-yl)-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide |
|---|---|
| PubChem CID | 118106992 |
| Molecular Formula | C23H25N7O |
| Molecular Weight | 415.50 g/mol |
| Exact Mass | 415.21 |
| IUPAC Name | (9S)-5-(2-methyl-4-pyridinyl)-N-(6-propan-2-ylpyrazin-2-yl)-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide |
| SMILES | Cc1cc(-c2ccc3c(n2)N(C(=O)Nc2cncc(C(C)C)n2)[C@H]2CCN3C2)ccn1 |
| InChI | InChI=1S/C23H25N7O/c1-14(2)19-11-24-12-21(26-19)28-23(31)30-17-7-9-29(13-17)20-5-4-18(27-22(20)30)16-6-8-25-15(3)10-16/h4-6,8,10-12,14,17H,7,9,13H2,1-3H3,(H,26,28,31)/t17-/m0/s1 |
| InChIKey | PJVJZXGEKNKFEJ-KRWDZBQOSA-N |
| XLogP | 4.00 |
| TPSA | 87.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.50 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |