C21H19ClN6O — CID 118969355
5-(3-chlorophenyl)-N-pyrimidin-4-yl-1,6,8-triazatricyclo[7.2.2.02,7]trideca-2(7),3,5-triene-8-carboxamide (PubChem CID 118969355) has the molecular formula C21H19ClN6O and a molecular weight of 406.88 g/mol. Its IUPAC name is 5-(3-chlorophenyl)-N-pyrimidin-4-yl-1,6,8-triazatricyclo[7.2.2.02,7]trideca-2(7),3,5-triene-8-carboxamide.
| Compound Name | 5-(3-chlorophenyl)-N-pyrimidin-4-yl-1,6,8-triazatricyclo[7.2.2.02,7]trideca-2(7),3,5-triene-8-carboxamide |
|---|---|
| PubChem CID | 118969355 |
| Molecular Formula | C21H19ClN6O |
| Molecular Weight | 406.88 g/mol |
| Exact Mass | 406.13 |
| IUPAC Name | 5-(3-chlorophenyl)-N-pyrimidin-4-yl-1,6,8-triazatricyclo[7.2.2.02,7]trideca-2(7),3,5-triene-8-carboxamide |
| SMILES | O=C(Nc1ccncn1)N1c2nc(-c3cccc(Cl)c3)ccc2N2CCC1CC2 |
| InChI | InChI=1S/C21H19ClN6O/c22-15-3-1-2-14(12-15)17-4-5-18-20(25-17)28(16-7-10-27(18)11-8-16)21(29)26-19-6-9-23-13-24-19/h1-6,9,12-13,16H,7-8,10-11H2,(H,23,24,26,29) |
| InChIKey | JPGGVRZGTKXKFL-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 74.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.88 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |