C22H23N7 — CID 137400679
N-[1-[(9S)-5-[3-(aminomethyl)phenyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-trien-8-yl]ethenyl]pyrimidin-4-amine (PubChem CID 137400679) has the molecular formula C22H23N7 and a molecular weight of 385.48 g/mol. Its IUPAC name is N-[1-[(9S)-5-[3-(aminomethyl)phenyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-trien-8-yl]ethenyl]pyrimidin-4-amine.
| Compound Name | N-[1-[(9S)-5-[3-(aminomethyl)phenyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-trien-8-yl]ethenyl]pyrimidin-4-amine |
|---|---|
| PubChem CID | 137400679 |
| Molecular Formula | C22H23N7 |
| Molecular Weight | 385.48 g/mol |
| Exact Mass | 385.20 |
| IUPAC Name | N-[1-[(9S)-5-[3-(aminomethyl)phenyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-trien-8-yl]ethenyl]pyrimidin-4-amine |
| SMILES | C=C(Nc1ccncn1)N1c2nc(-c3cccc(CN)c3)ccc2N2CC[C@H]1C2 |
| InChI | InChI=1S/C22H23N7/c1-15(26-21-7-9-24-14-25-21)29-18-8-10-28(13-18)20-6-5-19(27-22(20)29)17-4-2-3-16(11-17)12-23/h2-7,9,11,14,18H,1,8,10,12-13,23H2,(H,24,25,26)/t18-/m0/s1 |
| InChIKey | JIUYPUJOYXBQLD-SFHVURJKSA-N |
| XLogP | 2.98 |
| TPSA | 83.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.48 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |