C25H27N5O — CID 118124588
(9S)-N-[4-(aminomethyl)phenyl]-5-(3-methylphenyl)-1,6,8-triazatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-8-carboxamide (PubChem CID 118124588) has the molecular formula C25H27N5O and a molecular weight of 413.53 g/mol. Its IUPAC name is (9S)-N-[4-(aminomethyl)phenyl]-5-(3-methylphenyl)-1,6,8-triazatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-8-carboxamide.
| Compound Name | (9S)-N-[4-(aminomethyl)phenyl]-5-(3-methylphenyl)-1,6,8-triazatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-8-carboxamide |
|---|---|
| PubChem CID | 118124588 |
| Molecular Formula | C25H27N5O |
| Molecular Weight | 413.53 g/mol |
| Exact Mass | 413.22 |
| IUPAC Name | (9S)-N-[4-(aminomethyl)phenyl]-5-(3-methylphenyl)-1,6,8-triazatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-8-carboxamide |
| SMILES | Cc1cccc(-c2ccc3c(n2)N(C(=O)Nc2ccc(CN)cc2)[C@H]2CCCN3C2)c1 |
| InChI | InChI=1S/C25H27N5O/c1-17-4-2-5-19(14-17)22-11-12-23-24(28-22)30(21-6-3-13-29(23)16-21)25(31)27-20-9-7-18(15-26)8-10-20/h2,4-5,7-12,14,21H,3,6,13,15-16,26H2,1H3,(H,27,31)/t21-/m0/s1 |
| InChIKey | KSEPBQQCMXLHEV-NRFANRHFSA-N |
| XLogP | 4.54 |
| TPSA | 74.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.53 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |