C24H28N6OS — CID 118969228
(9S)-5-[3-(dimethylamino)phenyl]-N-(4,5-dimethyl-1,3-thiazol-2-yl)-1,6,8-triazatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-8-carboxamide (PubChem CID 118969228) has the molecular formula C24H28N6OS and a molecular weight of 448.60 g/mol. Its IUPAC name is (9S)-5-[3-(dimethylamino)phenyl]-N-(4,5-dimethyl-1,3-thiazol-2-yl)-1,6,8-triazatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-8-carboxamide.
| Compound Name | (9S)-5-[3-(dimethylamino)phenyl]-N-(4,5-dimethyl-1,3-thiazol-2-yl)-1,6,8-triazatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-8-carboxamide |
|---|---|
| PubChem CID | 118969228 |
| Molecular Formula | C24H28N6OS |
| Molecular Weight | 448.60 g/mol |
| Exact Mass | 448.20 |
| IUPAC Name | (9S)-5-[3-(dimethylamino)phenyl]-N-(4,5-dimethyl-1,3-thiazol-2-yl)-1,6,8-triazatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-8-carboxamide |
| SMILES | Cc1nc(NC(=O)N2c3nc(-c4cccc(N(C)C)c4)ccc3N3CCC[C@H]2C3)sc1C |
| InChI | InChI=1S/C24H28N6OS/c1-15-16(2)32-23(25-15)27-24(31)30-19-9-6-12-29(14-19)21-11-10-20(26-22(21)30)17-7-5-8-18(13-17)28(3)4/h5,7-8,10-11,13,19H,6,9,12,14H2,1-4H3,(H,25,27,31)/t19-/m0/s1 |
| InChIKey | IIIBTYNWIVHNAA-IBGZPJMESA-N |
| XLogP | 4.91 |
| TPSA | 64.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.60 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |