C25H27FN6 — CID 137401228
N-[1-[5-[3-(dimethylamino)phenyl]-1,6,8-triazatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-8-yl]ethenyl]-5-fluoropyridin-2-amine (PubChem CID 137401228) has the molecular formula C25H27FN6 and a molecular weight of 430.53 g/mol. Its IUPAC name is N-[1-[5-[3-(dimethylamino)phenyl]-1,6,8-triazatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-8-yl]ethenyl]-5-fluoropyridin-2-amine.
| Compound Name | N-[1-[5-[3-(dimethylamino)phenyl]-1,6,8-triazatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-8-yl]ethenyl]-5-fluoropyridin-2-amine |
|---|---|
| PubChem CID | 137401228 |
| Molecular Formula | C25H27FN6 |
| Molecular Weight | 430.53 g/mol |
| Exact Mass | 430.23 |
| IUPAC Name | N-[1-[5-[3-(dimethylamino)phenyl]-1,6,8-triazatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-8-yl]ethenyl]-5-fluoropyridin-2-amine |
| SMILES | C=C(Nc1ccc(F)cn1)N1c2nc(-c3cccc(N(C)C)c3)ccc2N2CCCC1C2 |
| InChI | InChI=1S/C25H27FN6/c1-17(28-24-12-9-19(26)15-27-24)32-21-8-5-13-31(16-21)23-11-10-22(29-25(23)32)18-6-4-7-20(14-18)30(2)3/h4,6-7,9-12,14-15,21H,1,5,8,13,16H2,2-3H3,(H,27,28) |
| InChIKey | GNEDZGHLDZSWLA-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 47.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.53 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |