C21H20FN7 — CID 137401011
N-[1-[5-(5-fluoro-3-pyridinyl)-1,6,8-triazatricyclo[7.2.2.02,7]trideca-2(7),3,5-trien-8-yl]ethenyl]pyrazin-2-amine (PubChem CID 137401011) has the molecular formula C21H20FN7 and a molecular weight of 389.44 g/mol. Its IUPAC name is N-[1-[5-(5-fluoro-3-pyridinyl)-1,6,8-triazatricyclo[7.2.2.02,7]trideca-2(7),3,5-trien-8-yl]ethenyl]pyrazin-2-amine.
| Compound Name | N-[1-[5-(5-fluoro-3-pyridinyl)-1,6,8-triazatricyclo[7.2.2.02,7]trideca-2(7),3,5-trien-8-yl]ethenyl]pyrazin-2-amine |
|---|---|
| PubChem CID | 137401011 |
| Molecular Formula | C21H20FN7 |
| Molecular Weight | 389.44 g/mol |
| Exact Mass | 389.18 |
| IUPAC Name | N-[1-[5-(5-fluoro-3-pyridinyl)-1,6,8-triazatricyclo[7.2.2.02,7]trideca-2(7),3,5-trien-8-yl]ethenyl]pyrazin-2-amine |
| SMILES | C=C(Nc1cnccn1)N1c2nc(-c3cncc(F)c3)ccc2N2CCC1CC2 |
| InChI | InChI=1S/C21H20FN7/c1-14(26-20-13-23-6-7-25-20)29-17-4-8-28(9-5-17)19-3-2-18(27-21(19)29)15-10-16(22)12-24-11-15/h2-3,6-7,10-13,17H,1,4-5,8-9H2,(H,25,26) |
| InChIKey | OMILCNBSKRIUKD-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 70.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.44 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |