C21H21N7O — CID 118107090
(9S)-5-(6-ethyl-3-pyridinyl)-N-pyrazin-2-yl-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide (PubChem CID 118107090) has the molecular formula C21H21N7O and a molecular weight of 387.45 g/mol. Its IUPAC name is (9S)-5-(6-ethyl-3-pyridinyl)-N-pyrazin-2-yl-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide.
| Compound Name | (9S)-5-(6-ethyl-3-pyridinyl)-N-pyrazin-2-yl-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide |
|---|---|
| PubChem CID | 118107090 |
| Molecular Formula | C21H21N7O |
| Molecular Weight | 387.45 g/mol |
| Exact Mass | 387.18 |
| IUPAC Name | (9S)-5-(6-ethyl-3-pyridinyl)-N-pyrazin-2-yl-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide |
| SMILES | CCc1ccc(-c2ccc3c(n2)N(C(=O)Nc2cnccn2)[C@H]2CCN3C2)cn1 |
| InChI | InChI=1S/C21H21N7O/c1-2-15-4-3-14(11-24-15)17-5-6-18-20(25-17)28(16-7-10-27(18)13-16)21(29)26-19-12-22-8-9-23-19/h3-6,8-9,11-12,16H,2,7,10,13H2,1H3,(H,23,26,29)/t16-/m0/s1 |
| InChIKey | NIHLAZRCCOSJHU-INIZCTEOSA-N |
| XLogP | 3.13 |
| TPSA | 87.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.45 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |