C19H24N8O — CID 118107281
(9S)-5-(2-methylpiperazin-1-yl)-N-pyrazin-2-yl-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide (PubChem CID 118107281) has the molecular formula C19H24N8O and a molecular weight of 380.46 g/mol. Its IUPAC name is (9S)-5-(2-methylpiperazin-1-yl)-N-pyrazin-2-yl-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide.
| Compound Name | (9S)-5-(2-methylpiperazin-1-yl)-N-pyrazin-2-yl-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide |
|---|---|
| PubChem CID | 118107281 |
| Molecular Formula | C19H24N8O |
| Molecular Weight | 380.46 g/mol |
| Exact Mass | 380.21 |
| IUPAC Name | (9S)-5-(2-methylpiperazin-1-yl)-N-pyrazin-2-yl-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide |
| SMILES | CC1CNCCN1c1ccc2c(n1)N(C(=O)Nc1cnccn1)[C@H]1CCN2C1 |
| InChI | InChI=1S/C19H24N8O/c1-13-10-21-7-9-26(13)17-3-2-15-18(24-17)27(14-4-8-25(15)12-14)19(28)23-16-11-20-5-6-22-16/h2-3,5-6,11,13-14,21H,4,7-10,12H2,1H3,(H,22,23,28)/t13?,14-/m0/s1 |
| InChIKey | BDRATGNQMYSGTG-KZUDCZAMSA-N |
| XLogP | 1.30 |
| TPSA | 89.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.46 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |