C20H16N8O — CID 145083478
5-(6-cyano-3-pyridinyl)-N-pyrazin-2-yl-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide (PubChem CID 145083478) has the molecular formula C20H16N8O and a molecular weight of 384.40 g/mol. Its IUPAC name is 5-(6-cyano-3-pyridinyl)-N-pyrazin-2-yl-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide.
| Compound Name | 5-(6-cyano-3-pyridinyl)-N-pyrazin-2-yl-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide |
|---|---|
| PubChem CID | 145083478 |
| Molecular Formula | C20H16N8O |
| Molecular Weight | 384.40 g/mol |
| Exact Mass | 384.14 |
| IUPAC Name | 5-(6-cyano-3-pyridinyl)-N-pyrazin-2-yl-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide |
| SMILES | N#Cc1ccc(-c2ccc3c(n2)N(C(=O)Nc2cnccn2)C2CCN3C2)cn1 |
| InChI | InChI=1S/C20H16N8O/c21-9-14-2-1-13(10-24-14)16-3-4-17-19(25-16)28(15-5-8-27(17)12-15)20(29)26-18-11-22-6-7-23-18/h1-4,6-7,10-11,15H,5,8,12H2,(H,23,26,29) |
| InChIKey | ASCLWTSLKNYAGG-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 110.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.40 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |