C20H17ClN6O — CID 118969040
(9S)-5-(3-chlorophenyl)-N-pyrazin-2-yl-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide (PubChem CID 118969040) has the molecular formula C20H17ClN6O and a molecular weight of 392.85 g/mol. Its IUPAC name is (9S)-5-(3-chlorophenyl)-N-pyrazin-2-yl-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide.
| Compound Name | (9S)-5-(3-chlorophenyl)-N-pyrazin-2-yl-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide |
|---|---|
| PubChem CID | 118969040 |
| Molecular Formula | C20H17ClN6O |
| Molecular Weight | 392.85 g/mol |
| Exact Mass | 392.12 |
| IUPAC Name | (9S)-5-(3-chlorophenyl)-N-pyrazin-2-yl-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide |
| SMILES | O=C(Nc1cnccn1)N1c2nc(-c3cccc(Cl)c3)ccc2N2CC[C@H]1C2 |
| InChI | InChI=1S/C20H17ClN6O/c21-14-3-1-2-13(10-14)16-4-5-17-19(24-16)27(15-6-9-26(17)12-15)20(28)25-18-11-22-7-8-23-18/h1-5,7-8,10-11,15H,6,9,12H2,(H,23,25,28)/t15-/m0/s1 |
| InChIKey | TURZSIILZRDZJT-HNNXBMFYSA-N |
| XLogP | 3.82 |
| TPSA | 74.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.85 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |