C23H21ClN6O4 — CID 163650558
(9S)-5-(3-chlorophenyl)-N-[6-[(Z)-2,3-dihydroxyprop-2-enoxy]pyrazin-2-yl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide (PubChem CID 163650558) has the molecular formula C23H21ClN6O4 and a molecular weight of 480.91 g/mol. Its IUPAC name is (9S)-5-(3-chlorophenyl)-N-[6-[(Z)-2,3-dihydroxyprop-2-enoxy]pyrazin-2-yl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide.
| Compound Name | (9S)-5-(3-chlorophenyl)-N-[6-[(Z)-2,3-dihydroxyprop-2-enoxy]pyrazin-2-yl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide |
|---|---|
| PubChem CID | 163650558 |
| Molecular Formula | C23H21ClN6O4 |
| Molecular Weight | 480.91 g/mol |
| Exact Mass | 480.13 |
| IUPAC Name | (9S)-5-(3-chlorophenyl)-N-[6-[(Z)-2,3-dihydroxyprop-2-enoxy]pyrazin-2-yl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-8-carboxamide |
| SMILES | O=C(Nc1cncc(OC/C(O)=C/O)n1)N1c2nc(-c3cccc(Cl)c3)ccc2N2CC[C@H]1C2 |
| InChI | InChI=1S/C23H21ClN6O4/c24-15-3-1-2-14(8-15)18-4-5-19-22(26-18)30(16-6-7-29(19)11-16)23(33)28-20-9-25-10-21(27-20)34-13-17(32)12-31/h1-5,8-10,12,16,31-32H,6-7,11,13H2,(H,27,28,33)/b17-12-/t16-/m0/s1 |
| InChIKey | ILXBNPCASKSKNW-BQGMYUGNSA-N |
| XLogP | 4.16 |
| TPSA | 123.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.91 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|