C21H20N8O — CID 145087239
5-(8-methyl-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-trien-5-yl)pyridine-2-carbonitrile;N-pyrazin-2-ylformamide (PubChem CID 145087239) has the molecular formula C21H20N8O and a molecular weight of 400.45 g/mol. Its IUPAC name is 5-(8-methyl-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-trien-5-yl)pyridine-2-carbonitrile;N-pyrazin-2-ylformamide.
| Compound Name | 5-(8-methyl-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-trien-5-yl)pyridine-2-carbonitrile;N-pyrazin-2-ylformamide |
|---|---|
| PubChem CID | 145087239 |
| Molecular Formula | C21H20N8O |
| Molecular Weight | 400.45 g/mol |
| Exact Mass | 400.18 |
| IUPAC Name | 5-(8-methyl-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-trien-5-yl)pyridine-2-carbonitrile;N-pyrazin-2-ylformamide |
| SMILES | CN1c2nc(-c3ccc(C#N)nc3)ccc2N2CCC1C2.O=CNc1cnccn1 |
| InChI | InChI=1S/C16H15N5.C5H5N3O/c1-20-13-6-7-21(10-13)15-5-4-14(19-16(15)20)11-2-3-12(8-17)18-9-11;9-4-8-5-3-6-1-2-7-5/h2-5,9,13H,6-7,10H2,1H3;1-4H,(H,7,8,9) |
| InChIKey | NKYILLDKWOUMGE-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 110.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.45 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|