C22H21F3N6O — CID 145087241
8-methyl-5-[6-(trifluoromethyl)-3-pyridinyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene;N-pyridin-3-ylformamide (PubChem CID 145087241) has the molecular formula C22H21F3N6O and a molecular weight of 442.45 g/mol. Its IUPAC name is 8-methyl-5-[6-(trifluoromethyl)-3-pyridinyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene;N-pyridin-3-ylformamide.
| Compound Name | 8-methyl-5-[6-(trifluoromethyl)-3-pyridinyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene;N-pyridin-3-ylformamide |
|---|---|
| PubChem CID | 145087241 |
| Molecular Formula | C22H21F3N6O |
| Molecular Weight | 442.45 g/mol |
| Exact Mass | 442.17 |
| IUPAC Name | 8-methyl-5-[6-(trifluoromethyl)-3-pyridinyl]-1,6,8-triazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene;N-pyridin-3-ylformamide |
| SMILES | CN1c2nc(-c3ccc(C(F)(F)F)nc3)ccc2N2CCC1C2.O=CNc1cccnc1 |
| InChI | InChI=1S/C16H15F3N4.C6H6N2O/c1-22-11-6-7-23(9-11)13-4-3-12(21-15(13)22)10-2-5-14(20-8-10)16(17,18)19;9-5-8-6-2-1-3-7-4-6/h2-5,8,11H,6-7,9H2,1H3;1-5H,(H,8,9) |
| InChIKey | YXIBHKQGVAXCLA-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 74.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.45 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|